| Product Name | carbamic acid, compound with propylenediamine |
| CAS No. | 55911-95-0 |
| Synonyms | Carbamic acid, compd. with 1,2-propanediamine (1:?); 1,2-Propylenediamine carbamate; Carbamic acid, compd. with 1,2-propanediamine; Carbamic acid, compound with propylenediamine; carbamic acid - propane-1,2-diamine (1:1) |
| InChI | InChI=1/C3H10N2.CH3NO2/c1-3(5)2-4;2-1(3)4/h3H,2,4-5H2,1H3;2H2,(H,3,4) |
| Molecular Formula | C4H13N3O2 |
| Molecular Weight | 135.1649 |
| Boiling point | 117.3°C at 760 mmHg |
| Flash point | 33.3°C |
55911-95-0 carbamic acid, compound with propylenediamine
service@apichina.com