| Product Name | C-Undecylcalix[4]resorcinarene monohydrate |
| CAS No. | 112247-07-1 |
| Synonyms | C-undecylcalix(4)resorcinarene mono-hydrate; 2,8,14,20-tetraundecylpentacyclo[19.3.1.1~3,7~.1~9,13~.1~15,19~]octacosa-1(25),3(28),4,6,9(27),10,12,15(26),16,18,21,23-dodecaene-4,6,10,12,16,18,22,24-octol |
| InChI | InChI=1/C72H112O8/c1-5-9-13-17-21-25-29-33-37-41-53-57-45-59(67(75)49-65(57)73)54(42-38-34-30-26-22-18-14-10-6-2)61-47-63(71(79)51-69(61)77)56(44-40-36-32-28-24-20-16-12-8-4)64-48-62(70(78)52-72(64)80)55(60-46-58(53)66(74)50-68(60)76)43-39-35-31-27-23-19-15-11-7-3/h45-56,73-80H,5-44H2,1-4H3 |
| Molecular Formula | C72H112O8 |
| Molecular Weight | 1105.6549 |
| Density | 1.039g/cm3 |
| Melting point | 295-298℃ |
| Boiling point | 1082.7°C at 760 mmHg |
| Flash point | 326.9°C |
| Refractive index | 1.544 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
112247-07-1 c-undecylcalix[4]resorcinarene monohydrate
service@apichina.com