| Product Name | butyric acid, monoester with propane-1,2,3-triol |
| CAS No. | 26999-06-4 |
| Synonyms | 1-Butyrylglycerol; AI3-28578; Butanoic acid, monoester with 1,2,3-propanetriol; Butyric acid, monoester with propane-1,2,3-triol; 2,3-dihydroxypropyl butanoate |
| InChI | InChI=1/C7H14O4/c1-2-3-7(10)11-5-6(9)4-8/h6,8-9H,2-5H2,1H3 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.1837 |
| Density | 1.134g/cm3 |
| Boiling point | 280.5°C at 760 mmHg |
| Flash point | 111.3°C |
| Refractive index | 1.461 |
26999-06-4 butyric acid, monoester with propane-1,2,3-triol
service@apichina.com