| Product Name | butylammonium oleate |
| CAS No. | 26094-13-3 |
| Synonyms | Butylamine oleate; Butylammonium oleate; 9-Octadecenoic acid (9Z)-, compd. with 1-butanamine (1:1); 9-Octadecenoic acid (Z)-, compd. with 1-butanamine (1:1) (9CI); Oleic acid, compd. with butylamine (1:1); 9-Octadecenoic acid (Z)-, compd. with 1-butanamine (1:1); (9E)-octadec-9-enoic acid - butan-1-amine (1:1) |
| InChI | InChI=1/C18H34O2.C4H11N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-5H2,1H3/b10-9+; |
| Molecular Formula | C22H45NO2 |
| Molecular Weight | 355.5982 |
| Boiling point | 456.8°C at 760 mmHg |
| Flash point | 230.1°C |
26094-13-3 butylammonium oleate
service@apichina.com