| Product Name | butyl thioglycolate |
| CAS No. | 10047-28-6 |
| InChI | InChI=1/C6H12O2S/c1-2-3-4-9-6(8)5-7/h7H,2-5H2,1H3 |
| Molecular Formula | C6H12O2S |
| Molecular Weight | 148.2233 |
| Density | 1.088g/cm3 |
| Boiling point | 220.125°C at 760 mmHg |
| Flash point | 86.929°C |
| Refractive index | 1.491 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S36/37:Wear suitable protective clothing and gloves.; |
10047-28-6 butyl thioglycolate
service@apichina.com