| Product Name | Butyl 3-mercaptopropionate |
| CAS No. | 16215-21-7 |
| Synonyms | Propanoic acid, 3-mercapto-, butyl ester; Butyl mercaptopropionate; NSC 54830; beta-Mercaptopropionic acid, butyl ester; Propionic acid, 3-mercapto-, butyl ester; butyl 3-sulfanylpropanoate |
| InChI | InChI=1/C7H14O2S/c1-2-3-5-9-7(8)4-6-10/h10H,2-6H2,1H3 |
| Molecular Formula | C7H14O2S |
| Molecular Weight | 162.2499 |
| Density | 1.003g/cm3 |
| Boiling point | 216.9°C at 760 mmHg |
| Flash point | 93.3°C |
| Refractive index | 1.458 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
16215-21-7 butyl 3-mercaptopropionate
service@apichina.com