| Product Name | Butadiene sulfone |
| CAS No. | 77-79-2 |
| Synonyms | 2,5-Dihydrothiophene-1,1-dioxide; 3-Sulfolene; Dihydrothiophene-1,1-dioxide; Butadiene sulphone; Cyclobutenesulfone |
| InChI | InChI=1/C4H6O2S/c5-7(6)3-1-2-4-7/h1-2H,3-4H2 |
| Molecular Formula | C4H6O2S |
| Molecular Weight | 118.15 |
| Density | 1.314 |
| Melting point | 63-66℃ |
| Flash point | 112℃ |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
77-79-2 butadiene sulfone
service@apichina.com