| Product Name | Bromochloroacetonitrile |
| CAS No. | 83463-62-1 |
| Synonyms | Bromochloromethyl cyanide; CCRIS 2672; HSDB 7617; Acetonitrile, bromochloro- |
| InChI | InChI=1/C2HBrClN/c3-2(4)1-5/h2H |
| Molecular Formula | C2HBrClN |
| Molecular Weight | 154.393 |
| Density | 1.932g/cm3 |
| Boiling point | 121.1°C at 760 mmHg |
| Flash point | 27.1°C |
| Refractive index | 1.506 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
83463-62-1 bromochloroacetonitrile
service@apichina.com