| Product Name | Boric acid (H3BO3), reaction products with ethanolamine and triethanolamine |
| CAS No. | 68512-53-8 |
| Synonyms | Triethanolamine, ethanolamine, boric acid reaction products; 2-aminoethanol; 2-(bis(2-hydroxyethyl)amino)ethanol; boric acid |
| InChI | InChI=1/C6H15NO3.C2H7NO.BH3O3/c8-4-1-7(2-5-9)3-6-10;3-1-2-4;2-1(3)4/h8-10H,1-6H2;4H,1-3H2;2-4H |
| Molecular Formula | C8H25BN2O7 |
| Molecular Weight | 272.1043 |
| Boiling point | 335.4°C at 760 mmHg |
| Flash point | 185°C |
68512-53-8 boric acid (h3bo3), reaction products with ethanolamine and triethanolamine
service@apichina.com