| Product Name | Bis(tetramethylene)fluoroformamidinium hexafluorophosphate |
| CAS No. | 164298-25-3 |
| Synonyms | BTFFH~Fluorobis(tetramethylene)formamidinium hexafluorophosphate; Fluoro-N,N,N,N-bis(tetramethylene)formamidinium hexafluorophosphate; 1-[fluoro(pyrrolidin-1-yl)methylidene]pyrrolidinium hexafluorophosphate; BTFFH |
| InChI | InChI=1/C9H16FN2.F6P/c10-9(11-5-1-2-6-11)12-7-3-4-8-12;1-7(2,3,4,5)6/h1-8H2;/q+1;-1 |
| Molecular Formula | C9H16F7N2P |
| Molecular Weight | 171.23 |
| Melting point | 152-157℃ |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
164298-25-3 bis(tetramethylene)fluoroformamidinium hexafluorophosphate
service@apichina.com