| Product Name | bis[(R)-12-hydroxyoleic] acid, diester with glycerol |
| CAS No. | 27902-24-5 |
| Synonyms | Glyceryl diricinoleate; 12-Hydroxy-9-octadecenoic acid, diester with 1,2,3-propanetriol; 9-Octadecenoic acid, 12-hydroxy-, diester with 1,2,3-propanetriol; (Z,Z)-12-Hydroxy-9-octadecenoic acid, diester with 1,2,3-propanetriol; Castor oil diester with glycerine; 9-Octadecenoic acid, 12-hydroxy-, (9Z,12R)-, diester with 1,2,3-propanetriol; 9-Octadecenoic acid, 12-hydroxy-, diester with 1,2,3-propanetriol, (9Z,9'Z,12R,12'R)-; Bis((R)-12-hydroxyoleic) acid, diester with glycerol; 2-hydroxypropane-1,3-diyl (9E,9'E)bis(12-hydroxyoctadec-9-enoate); [2-hydroxy-3-(12-hydroxyoctadec-9-enoyloxy)propyl] 12-hydroxyoctadec-9-enoate |
| InChI | InChI=1/C39H72O7/c1-3-5-7-21-27-35(40)29-23-17-13-9-11-15-19-25-31-38(43)45-33-37(42)34-46-39(44)32-26-20-16-12-10-14-18-24-30-36(41)28-22-8-6-4-2/h17-18,23-24,35-37,40-42H,3-16,19-22,25-34H2,1-2H3 |
| Molecular Formula | C39H72O7 |
| Molecular Weight | 652.9848 |
| Density | 0.989g/cm3 |
| Boiling point | 728.4°C at 760 mmHg |
| Flash point | 206°C |
| Refractive index | 1.49 |
27902-24-5 bis[(r)-12-hydroxyoleic] acid, diester with glycerol
service@apichina.com