| Product Name | Bis(4-methyl-1-piperazinylthiocarbonyl) disulfide |
| CAS No. | 20231-01-0 |
| Synonyms | Ewp 815; 4-Methylpiperazino-thiuramdisulfide; 5-23-01-00114 (Beilstein Handbook Reference); BRN 0893745; Bis((4-methyl-1-piperazinyl)thiocarbonyl)disulfide; Disulfide, bis((4-methyl-1-piperazinyl)thiocarbonyl); Piperazine, 1,1'-(dithiodicarbonothioyl)bis(4-methyl-; bis(4-methylpiperazin-1-yl)dithioperoxyanhydride |
| InChI | InChI=1/C12H22N4S4/c1-13-3-7-15(8-4-13)11(17)19-20-12(18)16-9-5-14(2)6-10-16/h3-10H2,1-2H3 |
| Molecular Formula | C12H22N4S4 |
| Molecular Weight | 350.5899 |
| Density | 1.339g/cm3 |
| Melting point | 142℃ |
| Boiling point | 450.5°C at 760 mmHg |
| Flash point | 226.3°C |
| Refractive index | 1.673 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
20231-01-0 bis(4-methyl-1-piperazinylthiocarbonyl) disulfide
service@apichina.com