| Product Name | Bis(4-methoxyphenyl) disulphide |
| CAS No. | 5335-87-5 |
| Synonyms | 4-Methoxyphenyl disulphide; 1,1'-disulfanediylbis(4-methoxybenzene); N-(1-phenylethyl)tricyclo[3.3.1.1~3,7~]decane-1-carboxamide |
| InChI | InChI=1/C19H25NO/c1-13(17-5-3-2-4-6-17)20-18(21)19-10-14-7-15(11-19)9-16(8-14)12-19/h2-6,13-16H,7-12H2,1H3,(H,20,21) |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.4079 |
| Density | 1.123g/cm3 |
| Melting point | 40℃ |
| Boiling point | 465.4°C at 760 mmHg |
| Flash point | 283.8°C |
| Refractive index | 1.58 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
5335-87-5 bis(4-methoxyphenyl) disulphide
service@apichina.com