| Product Name | Bis(2-thienyl) ketone |
| CAS No. | 704-38-1 |
| Synonyms | Di-2-thienyl ketone; Bis(2-thienyl)ketone~Di-2-thienyl ketone; dithiophen-2-ylmethanone |
| InChI | InChI=1/C9H6OS2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h1-6H |
| Molecular Formula | C9H6OS2 |
| Molecular Weight | 194.2733 |
| Density | 1.326g/cm3 |
| Melting point | 89-91℃ |
| Boiling point | 323°C at 760 mmHg |
| Flash point | 149.1°C |
| Refractive index | 1.64 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
704-38-1 bis(2-thienyl) ketone
service@apichina.com