| Product Name | bis(2-methoxyphenyl) carbonate |
| CAS No. | 553-17-3 |
| Synonyms | diguaiacyl carbonate; guaiacyl carbonate; Guaiacol carbonate |
| InChI | InChI=1/C15H14O5/c1-17-11-7-3-5-9-13(11)19-15(16)20-14-10-6-4-8-12(14)18-2/h3-10H,1-2H3 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.2687 |
| Density | 1.208g/cm3 |
| Boiling point | 392.6°C at 760 mmHg |
| Flash point | 173.7°C |
| Refractive index | 1.552 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
553-17-3 bis(2-methoxyphenyl) carbonate
service@apichina.com