| Product Name | bis(2-aminoethanol), diester with boric acid |
| CAS No. | 22232-01-5 |
| Synonyms | Ethanol, 2-amino-, 1,1'-diester with boric acid (H3BO3); Bis(2-aminoethyl)borate; Boric acid, monoethanolamine diester; Caswell No. 088; Bis(2-aminoethanol), diester with boric acid; Ethanol, 2-amino-, diester with boric acid (H3BO3); bis(2-aminoethyl) hydrogen borate |
| InChI | InChI=1/C4H13BN2O3/c6-1-3-9-5(8)10-4-2-7/h8H,1-4,6-7H2 |
| Molecular Formula | C4H13BN2O3 |
| Molecular Weight | 147.9686 |
| Density | 1.103g/cm3 |
| Boiling point | 243.4°C at 760 mmHg |
| Flash point | 101°C |
| Refractive index | 1.45 |
22232-01-5 bis(2-aminoethanol), diester with boric acid
service@apichina.com