| Product Name | Bicyclo[2.2.2]oct-2-ene-2,3-dicarboxylic anhydride |
| CAS No. | 151813-29-5 |
| Synonyms | 4,5,6,7-Tetrahydro-4,7-ethanoisobenzofuran-1,3-dione |
| InChI | InChI=1/C10H10O3/c11-9-7-5-1-2-6(4-3-5)8(7)10(12)13-9/h5-6H,1-4H2 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.1846 |
| Density | 1.34g/cm3 |
| Boiling point | 337.9°C at 760 mmHg |
| Flash point | 164.6°C |
| Refractive index | 1.572 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
151813-29-5 bicyclo[2.2.2]oct-2-ene-2,3-dicarboxylic anhydride
service@apichina.com