| Product Name | beta-Styrylboronic acid diethanolamine cyclic ester |
| CAS No. | 411222-52-1 |
| Synonyms | 2-[(E)-2-phenylethenyl]-1,3,6,2-dioxazaborocane |
| InChI | InChI=1/C12H16BNO2/c1-2-4-12(5-3-1)6-7-13-15-10-8-14-9-11-16-13/h1-7,14H,8-11H2/b7-6+ |
| Molecular Formula | C12H16BNO2 |
| Molecular Weight | 217.0719 |
| Density | 1.056g/cm3 |
| Boiling point | 309.584°C at 760 mmHg |
| Flash point | 141.032°C |
| Refractive index | 1.525 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
411222-52-1 beta-styrylboronic acid diethanolamine cyclic ester
service@apichina.com