| Product Name | Beta-Methylphenethylamine |
| CAS No. | 582-22-9 |
| Synonyms | 1-Amino-2-phenylpropane; 2-Phenylpropylamine; 2-phenylpropan-1-amine; (2R)-2-phenylpropan-1-aminium; (2S)-2-phenylpropan-1-aminium; β-Methylphenethylamine |
| InChI | InChI=1/C9H13N/c1-8(7-10)9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/p+1/t8-/m1/s1 |
| Molecular Formula | C9H14N |
| Molecular Weight | 136.2136 |
| Boiling point | 210°C at 760 mmHg |
| Flash point | 84.6°C |
| Hazard Symbols | |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
582-22-9 beta-methylphenethylamine
service@apichina.com