| Product Name | beta-butyrolactone |
| CAS No. | 3068-88-0 |
| Synonyms | Butyrolactone; dl-B-hydroxybutyric acid lactone; 3-Hydroxybutyric acid lactone; 4-Methyl-2-oxetanone; 2-Methyl-beta-propiolactone; dihydrofuran-2(3H)-one; (4R)-4-methyloxetan-2-one; (4S)-4-methyloxetan-2-one; (R)-BETA-BUTYROLACTONE |
| InChI | InChI=1/C4H6O2/c1-3-2-4(5)6-3/h3H,2H2,1H3/t3-/m0/s1 |
| Molecular Formula | C4H6O2 |
| Molecular Weight | 86.0892 |
| Density | 1.096g/cm3 |
| Boiling point | 163.2°C at 760 mmHg |
| Flash point | 34.1°C |
| Refractive index | 1.429 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; R45:May cause cancer.; |
| Safety | S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S53:Avoid exposure - obtain special instructions before use.; |
3068-88-0 beta-butyrolactone
service@apichina.com