| Product Name | beta-Bromoisopropylbenzene |
| CAS No. | 1459-00-3 |
| Synonyms | 1-Bromo-2-phenylpropane; beta-Bromocumene; 2-Phenylpropyl bromide; [(2S)-1-bromopropan-2-yl]benzene; β-Bromoisopropylbenzene |
| InChI | InChI=1/C9H11Br/c1-8(7-10)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3/t8-/m1/s1 |
| Molecular Formula | C9H11Br |
| Molecular Weight | 199.0876 |
| Density | 1.303g/cm3 |
| Boiling point | 188.5°C at 760 mmHg |
| Flash point | 85.9°C |
| Refractive index | 1.543 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1459-00-3 beta-bromoisopropylbenzene
service@apichina.com