| Product Name | beta,3-Dinitrostyrene |
| CAS No. | 882-26-8 |
| Synonyms | 2-Nitro-1-(3-nitrophenyl)ethene~3-Nitro-beta-nitrostyrene; 1-nitro-3-[(E)-2-nitroethenyl]benzene; 1-nitro-3-[(Z)-2-nitrovinyl]benzene |
| InChI | InChI=1/C8H6N2O4/c11-9(12)5-4-7-2-1-3-8(6-7)10(13)14/h1-6H/b5-4- |
| Molecular Formula | C8H6N2O4 |
| Molecular Weight | 194.1442 |
| Density | 1.401g/cm3 |
| Boiling point | 345.6°C at 760 mmHg |
| Flash point | 175.4°C |
| Refractive index | 1.642 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
882-26-8 beta,3-dinitrostyrene
service@apichina.com