| Product Name | beta,2-Dinitrostyrene |
| CAS No. | 3156-39-6 |
| Synonyms | 2-Nitro-1-(2-nitrophenyl)ethene~2-Nitro-beta-nitrostyrene; 1-nitro-2-[(E)-2-nitroethenyl]benzene |
| InChI | InChI=1/C8H6N2O4/c11-9(12)6-5-7-3-1-2-4-8(7)10(13)14/h1-6H/b6-5+ |
| Molecular Formula | C8H6N2O4 |
| Molecular Weight | 194.1442 |
| Density | 1.401g/cm3 |
| Boiling point | 356.6°C at 760 mmHg |
| Flash point | 183.3°C |
| Refractive index | 1.642 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3156-39-6 beta,2-dinitrostyrene
service@apichina.com