| Product Name | Benzyloxybromobenzene |
| CAS No. | 6793-92-6;152120-66-6 |
| Synonyms | 1-Benzyloxy-4-bromobenzene; 1-Bromo-4-benzyloxybenzene; Benzyl 4-bromophenyl ether; 4-Benzyloxybromobenzene; 5-(TERT-BUTYLDIMETHYLSILYL)-1-METHYL-1H; 1-(Benzyloxy)-4-bromobenzene; Benzene, 1-bromo-4-(phenylmethoxy)-; Benzyl 4-bromophenyl ether; Benzyl p-bromophenyl ether |
| InChI | InChI=1/C13H11BrO/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9H,10H2 |
| Molecular Formula | C13H11BrO |
| Molecular Weight | 263.13 |
| Melting point | 60-63℃ |
| Boiling point | 166-167℃ (4 mmHg) |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6793-92-6;152120-66-6 benzyloxybromobenzene
service@apichina.com