| Product Name | Benzylidenemalononitrile |
| CAS No. | 2700-22-3 |
| Synonyms | beta,beta-styrenedicarbonitrile; Benzalmalononitrile; 2-benzylidenemalononitrile; benzylidenepropanedinitrile |
| InChI | InChI=1/C10H6N2/c11-7-10(8-12)6-9-4-2-1-3-5-9/h1-6H |
| Molecular Formula | C10H6N2 |
| Molecular Weight | 154.168 |
| Density | 1.154g/cm3 |
| Melting point | 82-86℃ |
| Boiling point | 294.8°C at 760 mmHg |
| Flash point | 138°C |
| Refractive index | 1.612 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
2700-22-3 benzylidenemalononitrile
service@apichina.com