| Product Name | Benzylacrylate,(Acrylicacidbenzylester) |
| CAS No. | 2495-35-4 |
| Synonyms | Benzyl acrylate, (Acrylic acid benzyl ester); Benzyl acrylate; Acrylic acid benzyl ester; benzyl prop-2-enoatato |
| InChI | InChI=1/C10H10O2/c1-2-10(11)12-8-9-6-4-3-5-7-9/h2-7H,1,8H2 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.1852 |
| Density | 1.054g/cm3 |
| Boiling point | 228.7°C at 760 mmHg |
| Flash point | 115.5°C |
| Refractive index | 1.517 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28:After contact with skin, wash immediately with plenty of ...; S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
2495-35-4 benzylacrylate,(acrylicacidbenzylester)
service@apichina.com