| Product Name | Benzyl tiglate |
| CAS No. | 37526-88-8 |
| Synonyms | Tiglic acid benzyl ester; Benzyl trans-2,3-dimethylacrylate~Benzyl (E)-2-methyl-2-butenoate~Tiglic acid benzyl ester; benzyl 2-methylbut-2-enoate; benzyl (2E)-2-methylbut-2-enoate |
| InChI | InChI=1/C12H14O2/c1-3-10(2)12(13)14-9-11-7-5-4-6-8-11/h3-8H,9H2,1-2H3/b10-3+ |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.2384 |
| Density | 1.027g/cm3 |
| Boiling point | 267.7°C at 760 mmHg |
| Flash point | 135.9°C |
| Refractive index | 1.516 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
37526-88-8 benzyl tiglate
service@apichina.com