| Product Name | Benzyl phenyl sulfide |
| CAS No. | 831-91-4 |
| Synonyms | Benzyl phenyl sulphide; Benzyl phenyl sylphide; (benzylsulfanyl)benzene |
| InChI | InChI=1/C13H12S/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13/h1-10H,11H2 |
| Molecular Formula | C13H12S |
| Molecular Weight | 200.2994 |
| Density | 1.1g/cm3 |
| Melting point | 40-43℃ |
| Boiling point | 321.1°C at 760 mmHg |
| Flash point | 138.9°C |
| Refractive index | 1.626 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
831-91-4 benzyl phenyl sulfide
service@apichina.com