| Product Name | benzyl 4-bromotetrahydro-1(2H)-pyridinecarboxylate |
| CAS No. | 166953-64-6 |
| Synonyms | benzyl 4-bromopiperidine-1-carboxylate |
| InChI | InChI=1/C13H16BrNO2/c14-12-6-8-15(9-7-12)13(16)17-10-11-4-2-1-3-5-11/h1-5,12H,6-10H2 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.1756 |
| Density | 1.418g/cm3 |
| Boiling point | 385.1°C at 760 mmHg |
| Flash point | 186.7°C |
| Refractive index | 1.578 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
166953-64-6 benzyl 4-bromotetrahydro-1(2h)-pyridinecarboxylate
service@apichina.com