| Product Name | benzyl 4-(bromomethyl)tetrahydro-1(2H)-pyridinecarboxylate |
| CAS No. | 159275-17-9 |
| Synonyms | Benzyl 4-(bromoethyl)tetrahydro-1(2H)-pyridinecarboxylate; benzyl 4-(bromomethyl)piperidine-1-carboxylate; N-(Benzyloxycarbonyl)-4-(bromomethyl)piperidine |
| InChI | InChI=1/C14H18BrNO2/c15-10-12-6-8-16(9-7-12)14(17)18-11-13-4-2-1-3-5-13/h1-5,12H,6-11H2 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.2022 |
| Density | 1.356g/cm3 |
| Melting point | 67℃ |
| Boiling point | 403.4°C at 760 mmHg |
| Flash point | 197.8°C |
| Refractive index | 1.56 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
159275-17-9 benzyl 4-(bromomethyl)tetrahydro-1(2h)-pyridinecarboxylate
service@apichina.com