| Product Name | benzyl 3-(chlorocarbonyl)tetrahydro-1(2H)-pyridinecarboxylate |
| CAS No. | 216502-94-2 |
| InChI | InChI=1/C14H16NO3/c16-10-13-7-4-8-15(9-13)14(17)18-11-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-9,11H2 |
| Molecular Formula | C14H16NO3 |
| Molecular Weight | 246.2817 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
216502-94-2 benzyl 3-(chlorocarbonyl)tetrahydro-1(2h)-pyridinecarboxylate
service@apichina.com