| Product Name | benzyl 2-(chlorocarbonyl)-1-indolinecarboxylate |
| CAS No. | 321309-39-1 |
| Synonyms | benzyl 2-(chlorocarbonyl)-2,3-dihydro-1H-indole-1-carboxylate |
| InChI | InChI=1/C17H14ClNO3/c18-16(20)15-10-13-8-4-5-9-14(13)19(15)17(21)22-11-12-6-2-1-3-7-12/h1-9,15H,10-11H2 |
| Molecular Formula | C17H14ClNO3 |
| Molecular Weight | 315.751 |
| Density | 1.349g/cm3 |
| Melting point | 72℃ |
| Boiling point | 451.3°C at 760 mmHg |
| Flash point | 226.8°C |
| Refractive index | 1.62 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
321309-39-1 benzyl 2-(chlorocarbonyl)-1-indolinecarboxylate
service@apichina.com