| Product Name | benzoic acid, compound with dicyclohexylamine (1:1) |
| CAS No. | 22355-34-6 |
| Synonyms | Benzoic acid, compd. with N-cyclohexylcyclohexanamine (1:1); Benzoic acid dicyclohexylamine salt; Dicyclohexylamine benzoate; Dicyclohexylammonium benzoate; Benzoic acid, compd. with dicyclohexylamine (1:1) (8CI); Benzoic acid, compound with dicyclohexylamine (1:1); Dicyclohexylamine, compd. with benzoic acid (7CI); N-cyclohexylcyclohexanamine benzoate (1:1) |
| InChI | InChI=1/C12H23N.C7H6O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;8-7(9)6-4-2-1-3-5-6/h11-13H,1-10H2;1-5H,(H,8,9) |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.4391 |
| Boiling point | 256.1°C at 760 mmHg |
| Flash point | 96.1°C |
22355-34-6 benzoic acid, compound with dicyclohexylamine (1:1)
service@apichina.com