| Product Name | benzoic acid, compound with cyclohexylamine (1:1) |
| CAS No. | 3129-92-8 |
| Synonyms | Benzoic acid, compd. with cyclohexanamine (1:1); Benzoic acid, compd. with cyclohexylamine (1:1); Cyclohexylamine benzoate; Cyclohexylammonium benzoate; N-Cyclohexylammonium benzoate; NSC 211025; Benzoic acid, compd. with cyclohexylamine (1:1) (8CI); Benzoic acid, compound with cyclohexylamine (1:1); cyclohexanamine benzoate (1:1) |
| InChI | InChI=1/C7H6O2.C6H13N/c8-7(9)6-4-2-1-3-5-6;7-6-4-2-1-3-5-6/h1-5H,(H,8,9);6H,1-5,7H2 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.2955 |
| Boiling point | 249.3°C at 760 mmHg |
| Flash point | 111.4°C |
3129-92-8 benzoic acid, compound with cyclohexylamine (1:1)
service@apichina.com