| Product Name | Benzofuroxan-5-carboxylic acid |
| CAS No. | 6086-24-4 |
| Synonyms | 2,1,3-benzoxadiazole-5-carboxylic acid 1-oxide; 2,2'-(1,2,4-thiadiazole-3,5-diyldisulfanediyl)bis[1-(piperidin-1-yl)ethanone] |
| InChI | InChI=1/C16H24N4O2S3/c21-13(19-7-3-1-4-8-19)11-23-15-17-16(25-18-15)24-12-14(22)20-9-5-2-6-10-20/h1-12H2 |
| Molecular Formula | C16H24N4O2S3 |
| Molecular Weight | 400.5824 |
| Density | 1.37g/cm3 |
| Boiling point | 631.2°C at 760 mmHg |
| Flash point | 335.5°C |
| Refractive index | 1.641 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6086-24-4 benzofuroxan-5-carboxylic acid
service@apichina.com