| Product Name | Benzo[ghi]perylene |
| CAS No. | 191-24-2 |
| Synonyms | 1,12-Benzoperylene; Benzo[ghi]perylene (purity); benzo(g h i)perylene |
| InChI | InChI=1/C22H12/c1-3-13-7-9-15-11-12-16-10-8-14-4-2-6-18-17(5-1)19(13)21(15)22(16)20(14)18/h1-12H |
| Molecular Formula | C22H12 |
| Molecular Weight | 276.3307 |
| Density | 1.378g/cm3 |
| Melting point | 276-280℃ |
| Boiling point | 501°C at 760 mmHg |
| Flash point | 247.2°C |
| Refractive index | 2.009 |
| Hazard Symbols | |
| Risk Codes | R40:Possible risks of irreversible effects.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
191-24-2 benzo[ghi]perylene
service@apichina.com