| Product Name | Benzo[b]thiophene-3-acetic acid |
| CAS No. | 1131-09-5 |
| Synonyms | Thianaphthene-3-acetic acid; 1-benzothiophen-3-ylacetic acid |
| InChI | InChI=1/C10H8O2S/c11-10(12)5-7-6-13-9-4-2-1-3-8(7)9/h1-4,6H,5H2,(H,11,12) |
| Molecular Formula | C10H8O2S |
| Molecular Weight | 192.2343 |
| Density | 1.368g/cm3 |
| Boiling point | 378.7°C at 760 mmHg |
| Flash point | 182.9°C |
| Refractive index | 1.688 |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
1131-09-5 benzo[b]thiophene-3-acetic acid
service@apichina.com