| Product Name | Benzo[b]thiophene-2-carboxylic hydrazide |
| CAS No. | 175135-07-6 |
| Synonyms | Thianaphthene-2-carboxylic hydrazide; 1-benzothiophene-2-carbohydrazide |
| InChI | InChI=1/C9H8N2OS/c10-11-9(12)8-5-6-3-1-2-4-7(6)13-8/h1-5H,10H2,(H,11,12) |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.2376 |
| Density | 1.367g/cm3 |
| Melting point | 184℃ |
| Refractive index | 1.711 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
175135-07-6 benzo[b]thiophene-2-carboxylic hydrazide
service@apichina.com