| Product Name | Benzo[b]thiophene-2-carboxaldehyde |
| CAS No. | 3541-37-5 |
| Synonyms | 2-Formylbenzo[b]thiophene; Thianaphthene-2-carboxaldehyde; 1-Benzothiophene-2-carbaldehyde; Benzo[b]thiophene-2-carbaldehyde |
| InChI | InChI=1/C9H6OS/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-6H |
| Molecular Formula | C9H6OS |
| Molecular Weight | 162.2083 |
| Density | 1.3g/cm3 |
| Melting point | 32-36℃ |
| Boiling point | 303.2°C at 760 mmHg |
| Flash point | 137.2°C |
| Refractive index | 1.719 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:; S24/25:; |
3541-37-5 benzo[b]thiophene-2-carboxaldehyde
service@apichina.com