| Product Name | Benzo(b)furan-2-boronic acid |
| CAS No. | 98437-24-2 |
| Synonyms | Benzofuran-2-boronic acid; Benzo[b]furan-2-boronic acid; 1-Benzofuran-2-ylboronic acid; Benzofuran-2-ylboronic acid |
| InChI | InChI=1/C8H7BO3/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5,10-11H |
| Molecular Formula | C8H7BO3 |
| Molecular Weight | 161.9504 |
| Density | 1.31g/cm3 |
| Melting point | 114-116℃ |
| Boiling point | 340.4°C at 760 mmHg |
| Flash point | 159.7°C |
| Refractive index | 1.618 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
98437-24-2 benzo(b)furan-2-boronic acid
service@apichina.com