| Product Name | Benzhydryl isothiocyanate |
| CAS No. | 3550-21-8 |
| Synonyms | Diphenylmethyl isothiocyanate; 1,1'-(isothiocyanatomethanediyl)dibenzene |
| InChI | InChI=1/C14H11NS/c16-11-15-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14H |
| Molecular Formula | C14H11NS |
| Molecular Weight | 225.3088 |
| Density | 1.05g/cm3 |
| Melting point | 58℃ |
| Boiling point | 333.3°C at 760 mmHg |
| Flash point | 163°C |
| Refractive index | 1.59 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
3550-21-8 benzhydryl isothiocyanate
service@apichina.com