| Product Name | Benzenesulfonic acid, mono-C10-14-alkyl derivs., compds. with neutralized aniline-nitrobenzene reaction products |
| CAS No. | 97925-92-3 |
| Synonyms | Benzenesulfonic acid, mono-C10-14-alkyl derivs., compds. with neutralized aniline nitrobenzene reaction products; Benzenesulfonic acid, mono-C10-14-alkyl derivs, compds. with neutralized aniline-nitrobenzene reaction products; aniline, benzenesulfonic acid, nitrobenzene |
| InChI | InChI=1/C6H5NO2.C6H7N.C6H6O3S/c8-7(9)6-4-2-1-3-5-6;7-6-4-2-1-3-5-6;7-10(8,9)6-4-2-1-3-5-6/h1-5H;1-5H,7H2;1-5H,(H,7,8,9) |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.4109 |
97925-92-3 benzenesulfonic acid, mono-c10-14-alkyl derivs., compds. with neutralized aniline-nitrobe
service@apichina.com