| Product Name | benzeneacetaldehyde, cyclic acetal with glycerol |
| CAS No. | 29895-73-6 |
| Synonyms | Benzeneacetaldehyde, cyclic acetal with 1,2,3-propanetriol; 5-Hydroxy-2-benzyl-1,3-dioxan; 5-Hydroxymethyl-2-benzyl-1,3-dioxolane; Acetaldehyde, phenyl-, cyclic acetal with glycerol; Benzeneacetaldehyde 1,2,3-propanetriol cyclic acetal; Phenylacetaldehyde glyceryl acetal; Benzeneacetaldehyde, cyclic acetal with glycerol; (2-benzyl-1,3-dioxolan-4-yl)methanol |
| InChI | InChI=1/C11H14O3/c12-7-10-8-13-11(14-10)6-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.2271 |
| Density | 1.158g/cm3 |
| Boiling point | 316.9°C at 760 mmHg |
| Flash point | 156.5°C |
| Refractive index | 1.537 |
29895-73-6 benzeneacetaldehyde, cyclic acetal with glycerol
service@apichina.com