| Product Name | Benzene, 1-iodo-2,5-dimethoxy-4-methyl- |
| CAS No. | 75056-76-7 |
| Synonyms | 4-Iodo-2,5-dimethoxytoluene; 1-Iodo-2,5-dimethoxy-4-methylbenzene |
| InChI | InChI=1/C9H11IO2/c1-6-4-9(12-3)7(10)5-8(6)11-2/h4-5H,1-3H3 |
| Molecular Formula | C9H11IO2 |
| Molecular Weight | 278.0869 |
| Density | 1.581g/cm3 |
| Melting point | 84℃ |
| Boiling point | 308.9°C at 760 mmHg |
| Flash point | 140.6°C |
| Refractive index | 1.566 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
75056-76-7 benzene, 1-iodo-2,5-dimethoxy-4-methyl-
service@apichina.com