| Product Name | benzene-1,3-dithiol |
| CAS No. | 626-04-0 |
| Synonyms | 1,3-Benzenedithiol; 1,3-Dimercaptobenzene~Dithioresorcinol |
| InChI | InChI=1/C6H6S2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H |
| Molecular Formula | C6H6S2 |
| Molecular Weight | 142.2418 |
| Density | 1.24g/cm3 |
| Melting point | 24-25℃ |
| Boiling point | 244.3°C at 760 mmHg |
| Flash point | 112.7°C |
| Refractive index | 1.665 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
626-04-0 benzene-1,3-dithiol
service@apichina.com