| Product Name | Benzene, 1,2-dimethoxy-4-(1-propenyl)- |
| CAS No. | 93-16-3 |
| Synonyms | 1,2-Dimethoxy-4-propen-1-yl benzene; 3,4-Dimethoxy-1,1-propen-1-yl benzene; Isoeugenenyl methyl ether; Isoeugenol methyl ether; Isoeugenyl methyl ether; Methyl isoeugenol; ; 1,2-dimethoxy-4-(prop-1-en-1-yl)benzene; 2-methoxy-3-methyl-4-[(1E)-prop-1-en-1-yl]phenol; 2-methoxy-4-[(1E)-prop-1-en-1-yl]phenol - methoxymethane (1:1); 1,2-dimethoxy-4-[(Z)-prop-1-enyl]benzene |
| InChI | InChI=1/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4-8H,1-3H3/b5-4- |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.2277 |
| Density | 0.998g/cm3 |
| Melting point | 62.6℃ |
| Boiling point | 271.1°C at 760 mmHg |
| Flash point | 104.5°C |
| Refractive index | 1.534 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
93-16-3 benzene, 1,2-dimethoxy-4-(1-propenyl)-
service@apichina.com