| Product Name | Benzenamine, N-phenyl-, reaction products with 2,4,4-trimethylpentene |
| CAS No. | 68411-46-1 |
| Synonyms | N-phenylaniline - 2,4,4-trimethylpent-1-ene (1:1); Antioxidant 5057; Irganox 5057; Quantox-557; Alkyl diphenylamine; AN 5057; N-Phenylbenzenamine reactioin products with 2,4,4-trimethylpentene |
| InChI | InChI=1/C12H11N.C8H16/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7(2)6-8(3,4)5/h1-10,13H;1,6H2,2-5H3 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.4351 |
| Boiling point | 302°C at 760 mmHg |
| Flash point | 152.8°C |
68411-46-1 benzenamine, n-phenyl-, reaction products with 2,4,4-trimethylpentene
service@apichina.com