| Product Name | Benz[e]isatin |
| CAS No. | 5588-87-4 |
| Synonyms | 4,5-Benzoisatin; 1H-Benz[e]indole-1,2(3H)-dione; 1H-benzo[e]indole-1,2(3H)-dione |
| InChI | InChI=1/C12H7NO2/c14-11-10-8-4-2-1-3-7(8)5-6-9(10)13-12(11)15/h1-6H,(H,13,14,15) |
| Molecular Formula | C12H7NO2 |
| Molecular Weight | 197.1895 |
| Density | 1.391g/cm3 |
| Refractive index | 1.708 |
5588-87-4 benz[e]isatin
service@apichina.com