| Product Name | Bemegride |
| CAS No. | 64-65-3 |
| Synonyms | 3-Ethyl-3-methylglutarimide; 4-Ethyl-4-methyl-2,6-piperidinedione; 3-Methyl-3-ethylglutarimide; 4-ethyl-4-methylpiperidine-2,6-dione |
| InChI | InChI=1/C8H13NO2/c1-3-8(2)4-6(10)9-7(11)5-8/h3-5H2,1-2H3,(H,9,10,11) |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.1943 |
| Density | 1.024g/cm3 |
| Melting point | 126-129℃ |
| Boiling point | 282°C at 760 mmHg |
| Flash point | 125.8°C |
| Refractive index | 1.448 |
| Hazard Symbols | |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
64-65-3 bemegride
service@apichina.com