| Product Name | arecaidine hydrochloride |
| CAS No. | 6018-28-6 |
| Synonyms | 1-Methyl-1,2,5,6-tetrahydronicotinic acid hydrochloride; 5-carboxy-1-methyl-1,2,3,6-tetrahydropyridinium chloride |
| InChI | InChI=1/C7H11NO2.ClH/c1-8-4-2-3-6(5-8)7(9)10;/h3H,2,4-5H2,1H3,(H,9,10);1H |
| Molecular Formula | C7H12ClNO2 |
| Molecular Weight | 177.6287 |
| Boiling point | 266.7°C at 760 mmHg |
| Flash point | 115.1°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6018-28-6 arecaidine hydrochloride
service@apichina.com